CAS 934387-35-6 appears in our catalog under these names: ROCK-IN-1, 99+%, ROCK–IN–1, ROCK-IN-1, 98.17%, ROCK-IN-1. Offered by: AmBeed, GLPBio, MedChemExpress, Chemat. Available pack sizes: 100mg, 1mg, 10mg, 20mg, 5mg, 5 mg, 100 mg, 10 mg.
4-(1-aminoethyl)-3-(4-fluorophenyl)-N-pyridin-4-ylbenzamide (CAS 934387-35-6) is a chemical compound with the molecular formula C20H18FN3O and a molecular weight of 335.4 g/mol. IUPAC name: 4-(1-aminoethyl)-3-(4-fluorophenyl)-N-pyridin-4-ylbenzamide. InChIKey: JJNXXPMAFUVGRU-UHFFFAOYSA-N.
| Molecular formula | C20H18FN3O |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-(1-aminoethyl)-3-(4-fluorophenyl)-N-pyridin-4-ylbenzamide |
| InChIKey | JJNXXPMAFUVGRU-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C(=O)NC2=CC=NC=C2)C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)