CAS 491868-12-3 appears in our catalog under these names: 4-Hydroxybenzyl Methanethiosulfonate, 98%, 4-Hydroxybenzyl Methanethiosulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 25mg.
4-(methylsulfonylsulfanylmethyl)phenol (CAS 491868-12-3) is a chemical compound with the molecular formula C8H10O3S2 and a molecular weight of 218.3 g/mol. IUPAC name: 4-(methylsulfonylsulfanylmethyl)phenol. InChIKey: YPHDQZFGAJAIEG-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | 4-(methylsulfonylsulfanylmethyl)phenol |
| InChIKey | YPHDQZFGAJAIEG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)