Products 682360-46-9

CAS 682360-46-9 is the registry number for 2-(1,3-Dithian-2-ylidene)-3-oxobutanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1,3-dithian-2-ylidene)-3-oxobutanoic acid (CAS 682360-46-9) is a chemical compound with the molecular formula C8H10O3S2 and a molecular weight of 218.3 g/mol. IUPAC name: 2-(1,3-dithian-2-ylidene)-3-oxobutanoic acid. InChIKey: UZUCFOJNBZYGLO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O3S2
Molecular weight218.3 g/mol
IUPAC name2-(1,3-dithian-2-ylidene)-3-oxobutanoic acid
InChIKeyUZUCFOJNBZYGLO-UHFFFAOYSA-N
SMILESCC(=O)C(=C1SCCCS1)C(=O)O

Computed by PubChem (NCBI)