CAS 4920-79-0 appears in our catalog under these names: 2-Chloro-4-nitroanisole, 97%, 2–Chloro–4–nitroanisole, 2-Chloro-4-nitroanisole, >98.0%(GC), 2-Chloro-4-nitroanisole 97%, 2-Chloro-4-nitroanisole, 98%, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 500g, 1g.
2-chloro-1-methoxy-4-nitrobenzene (CAS 4920-79-0) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-1-methoxy-4-nitrobenzene. InChIKey: DLJPNXLHWMRQIQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-1-methoxy-4-nitrobenzene |
| InChIKey | DLJPNXLHWMRQIQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)