CAS 493015-74-0 appears in our catalog under these names: Pinolenic acid ethyl ester, 98%, Pinolenic Acid ethyl ester, Pinolenic Acid ethyl ester, Pinolenic Acid ethyl ester, 98%, 98%, Pinolenic acid ethyl ester, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10 mg, 25 mg, 5 mg.
Ethyl (5Z,9Z,12Z)-octadeca-5,9,12-trienoate (CAS 493015-74-0) is a chemical compound with the molecular formula C20H34O2 and a molecular weight of 306.5 g/mol. IUPAC name: ethyl (5Z,9Z,12Z)-octadeca-5,9,12-trienoate. InChIKey: VNRWOSFYACMRHX-UCVSHGSNSA-N.
| Molecular formula | C20H34O2 |
|---|---|
| Molecular weight | 306.5 g/mol |
| IUPAC name | ethyl (5Z,9Z,12Z)-octadeca-5,9,12-trienoate |
| InChIKey | VNRWOSFYACMRHX-UCVSHGSNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CC/C=C\CCCC(=O)OCC |
Computed by PubChem (NCBI)