Products 494762-76-4
CAS 494762-76-4 is the registry number for N-(4-hydroxyphenyl)(5-methyl-3-phenylisoxazol-4-yl)formamide. Offered by: Biosynth. Available pack sizes: 25g, 10g.
N-(4-hydroxyphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (CAS 494762-76-4) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: N-(4-hydroxyphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: UNFOWFJELXQCHB-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | UNFOWFJELXQCHB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)