CAS 494852-40-3 is the registry number for Azepan-1-yl(5-((2,4-dichlorophenoxy)methyl)furan-2-yl)methanone. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Azepan-1-yl-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methanone (CAS 494852-40-3) is a chemical compound with the molecular formula C18H19Cl2NO3 and a molecular weight of 368.3 g/mol. IUPAC name: azepan-1-yl-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methanone. InChIKey: KAKWSCYOEPHRJT-UHFFFAOYSA-N.
| Molecular formula | C18H19Cl2NO3 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | azepan-1-yl-[5-[(2,4-dichlorophenoxy)methyl]furan-2-yl]methanone |
| InChIKey | KAKWSCYOEPHRJT-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C(=O)C2=CC=C(O2)COC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)