Products 95093-57-5

CAS 95093-57-5 is the registry number for Diclofenac 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3-hydroxybutan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 95093-57-5) is a chemical compound with the molecular formula C18H19Cl2NO3 and a molecular weight of 368.3 g/mol. IUPAC name: 3-hydroxybutan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: QTZAVOLNOIMMAP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19Cl2NO3
Molecular weight368.3 g/mol
IUPAC name3-hydroxybutan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate
InChIKeyQTZAVOLNOIMMAP-UHFFFAOYSA-N
SMILESCC(C(C)OC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl)O

Computed by PubChem (NCBI)