Products 495-83-0
CAS 495-83-0 appears in our catalog under these names: Tigloidin (Tigloyl pseudotropine), (8-Methyl-8-azabicyclo(3.2.1)octan-3-yl) 2-methylbut-2-enoate, Tigloidin, 99.91%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 25mg, 50mg, 50 mg, 10 mg.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate (CAS 495-83-0) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate. InChIKey: UVHGSMZRSVGWDJ-ZCFDAEMWSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate |
| InChIKey | UVHGSMZRSVGWDJ-ZCFDAEMWSA-N |
| SMILES | C/C=C(\C)/C(=O)OC1C[C@H]2CC[C@@H](C1)N2C |
Computed by PubChem (NCBI)