Products 4956-27-8
CAS 4956-27-8 is the registry number for Ephedrine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;3-[(1S,2R)-2-amino-1-hydroxypropyl]phenol (CAS 4956-27-8) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;3-[(1S,2R)-2-amino-1-hydroxypropyl]phenol. InChIKey: MGIGEQKNVDGWIR-BSZLQLICSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;3-[(1S,2R)-2-amino-1-hydroxypropyl]phenol |
| InChIKey | MGIGEQKNVDGWIR-BSZLQLICSA-N |
| SMILES | C[C@H]([C@H](C1=CC(=CC=C1)O)O)N.C[C@@H]([C@@H](C1=CC(=CC=C1)O)O)N |
Computed by PubChem (NCBI)