CAS 496054-76-3 is the registry number for adamantanyl 4-(5-chloro-2-methylphenyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
1-adamantyl-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone (CAS 496054-76-3) is a chemical compound with the molecular formula C22H29ClN2O and a molecular weight of 372.9 g/mol. IUPAC name: 1-adamantyl-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone. InChIKey: ZIJGUWNTLOYDSF-UHFFFAOYSA-N.
| Molecular formula | C22H29ClN2O |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 1-adamantyl-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone |
| InChIKey | ZIJGUWNTLOYDSF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)C34CC5CC(C3)CC(C5)C4 |
Computed by PubChem (NCBI)