CAS 79278-68-5 is the registry number for N-((3S,4R)-1-Benzyl-3-methylpiperidin-4-yl)-N-phenylpropanamide, hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide;hydrochloride (CAS 79278-68-5) is a chemical compound with the molecular formula C22H29ClN2O and a molecular weight of 372.9 g/mol. IUPAC name: N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide;hydrochloride. InChIKey: LXCCVDBJSUYJDN-OZYANKIXSA-N.
| Molecular formula | C22H29ClN2O |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | N-[(3S,4R)-1-benzyl-3-methylpiperidin-4-yl]-N-phenylpropanamide;hydrochloride |
| InChIKey | LXCCVDBJSUYJDN-OZYANKIXSA-N |
| SMILES | CCC(=O)N([C@@H]1CCN(C[C@@H]1C)CC2=CC=CC=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)