CAS 496801-02-6 appears in our catalog under these names: 1-Iodo-2,4-bis(propan-2-yl)benzene, 95%, 1-Iodo-2,4-bis(propan-2-yl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-iodo-2,4-di(propan-2-yl)benzene (CAS 496801-02-6) is a chemical compound with the molecular formula C12H17I and a molecular weight of 288.17 g/mol. IUPAC name: 1-iodo-2,4-di(propan-2-yl)benzene. InChIKey: FOQSTELRKYHMFD-UHFFFAOYSA-N.
| Molecular formula | C12H17I |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | 1-iodo-2,4-di(propan-2-yl)benzene |
| InChIKey | FOQSTELRKYHMFD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)I)C(C)C |
Computed by PubChem (NCBI)