CAS 49701-24-8 is the registry number for 4-Amino-2,5-dimethoxy-N-methylbenzenesulfonamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2,5-dimethoxy-N-methylbenzenesulfonamide (CAS 49701-24-8) is a chemical compound with the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. IUPAC name: 4-amino-2,5-dimethoxy-N-methylbenzenesulfonamide. InChIKey: CISVVDNATRQDNU-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O4S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 4-amino-2,5-dimethoxy-N-methylbenzenesulfonamide |
| InChIKey | CISVVDNATRQDNU-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=C(C(=C1)OC)N)OC |
Computed by PubChem (NCBI)