CAS 7356-58-3 appears in our catalog under these names: Methyl carbamimidate 4-methylbenzenesulfonate, 98%, O-Methyliso Urea Tosylate Salt, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 5g.
4-methylbenzenesulfonic acid;methyl carbamimidate (CAS 7356-58-3) is a chemical compound with the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;methyl carbamimidate. InChIKey: CXDJHKQXACSXMZ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O4S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;methyl carbamimidate |
| InChIKey | CXDJHKQXACSXMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.COC(=N)N |
Computed by PubChem (NCBI)