CAS 497059-98-0 is the registry number for 2-((6-methyl-1,2,3,4-tetrahydroquinolyl)sulfonyl)thiophene. Offered by: Biosynth. Available pack sizes: 250mg.
6-methyl-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline (CAS 497059-98-0) is a chemical compound with the molecular formula C14H15NO2S2 and a molecular weight of 293.4 g/mol. IUPAC name: 6-methyl-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline. InChIKey: WTYGEMMWJGGXQE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 6-methyl-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline |
| InChIKey | WTYGEMMWJGGXQE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCC2)S(=O)(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)