CAS 49706-31-2 appears in our catalog under these names: Z–His–NHNH₂, Z-His-Nhnh2, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 5g, 1g.
Benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (CAS 49706-31-2) is a chemical compound with the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. IUPAC name: benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate. InChIKey: BOOAASJRVPZWJW-LBPRGKRZSA-N.
| Molecular formula | C14H17N5O3 |
|---|---|
| Molecular weight | 303.32 g/mol |
| IUPAC name | benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| InChIKey | BOOAASJRVPZWJW-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CN=CN2)C(=O)NN |
Computed by PubChem (NCBI)