CAS 497060-64-7 is the registry number for 2-(4-chloro-2-methylphenoxy)(3-pyridyl) 4-benzylpiperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(4-benzylpiperazin-1-yl)-[2-(4-chloro-2-methylphenoxy)-3-pyridinyl]methanone (CAS 497060-64-7) is a chemical compound with the molecular formula C24H24ClN3O2 and a molecular weight of 421.9 g/mol. IUPAC name: (4-benzylpiperazin-1-yl)-[2-(4-chloro-2-methylphenoxy)-3-pyridinyl]methanone. InChIKey: ZSSABHZIBVKWFO-UHFFFAOYSA-N.
| Molecular formula | C24H24ClN3O2 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | (4-benzylpiperazin-1-yl)-[2-(4-chloro-2-methylphenoxy)-3-pyridinyl]methanone |
| InChIKey | ZSSABHZIBVKWFO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC2=C(C=CC=N2)C(=O)N3CCN(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)