Products 699018-10-5
CAS 699018-10-5 is the registry number for Nile Blue Methacrylamide. Offered by: MedChemExpress. Available pack sizes: Get quote.
Diethyl-[5-(2-methylprop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride (CAS 699018-10-5) is a chemical compound with the molecular formula C24H24ClN3O2 and a molecular weight of 421.9 g/mol. IUPAC name: diethyl-[5-(2-methylprop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride. InChIKey: PPEXHWSVWLFAHE-UHFFFAOYSA-N.
| Molecular formula | C24H24ClN3O2 |
|---|---|
| Molecular weight | 421.9 g/mol |
| IUPAC name | diethyl-[5-(2-methylprop-2-enoylamino)benzo[a]phenoxazin-9-ylidene]azanium chloride |
| InChIKey | PPEXHWSVWLFAHE-UHFFFAOYSA-N |
| SMILES | CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)NC(=O)C(=C)C)OC2=C1)CC.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Nile Blue Methacrylamide, orb2565678