Products 497061-30-0
CAS 497061-30-0 is the registry number for 4-(2,6,6-trimethyl-4-oxo-5,6,7-trihydroindolyl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (CAS 497061-30-0) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: 4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide. InChIKey: DGGDKWPNFSCGSD-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| InChIKey | DGGDKWPNFSCGSD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)C(=O)N)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)