Products 49769-28-0

CAS 49769-28-0 is the registry number for 7-Phenylhept-6-ynoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

7-phenylhept-6-ynoic acid (CAS 49769-28-0) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: 7-phenylhept-6-ynoic acid. InChIKey: OXPQXCWBBDMQRS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O2
Molecular weight202.25 g/mol
IUPAC name7-phenylhept-6-ynoic acid
InChIKeyOXPQXCWBBDMQRS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C#CCCCCC(=O)O

Computed by PubChem (NCBI)