CAS 49843-49-4 appears in our catalog under these names: 3-T-Butyl-5-hydroxybenzoic acid, 98%, 3-tert-Butyl-5-hydroxybenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
3-tert-butyl-5-hydroxybenzoic acid (CAS 49843-49-4) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-tert-butyl-5-hydroxybenzoic acid. InChIKey: OKLRVPQXNHUNDN-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-tert-butyl-5-hydroxybenzoic acid |
| InChIKey | OKLRVPQXNHUNDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)O)O |
Computed by PubChem (NCBI)