CAS 498542-90-8 is the registry number for 5-Propylbenzene-1,3-diol-d5. Offered by: TRC. Available pack sizes: 25mg.
5-(2,2,3,3,3-pentadeuteriopropyl)benzene-1,3-diol (CAS 498542-90-8) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 157.22 g/mol. IUPAC name: 5-(2,2,3,3,3-pentadeuteriopropyl)benzene-1,3-diol. InChIKey: FRNQLQRBNSSJBK-ZBJDZAJPSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 157.22 g/mol |
| IUPAC name | 5-(2,2,3,3,3-pentadeuteriopropyl)benzene-1,3-diol |
| InChIKey | FRNQLQRBNSSJBK-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)