Products 498547-96-9
CAS 498547-96-9 appears in our catalog under these names: 4-(5-Tert-butyl-1,2,4-oxadiazol-3-yl)aniline, 95%, 4-(5-tert-Butyl-1,2,4-oxadiazol-3-yl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)aniline (CAS 498547-96-9) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)aniline. InChIKey: YZTPLJDEDDWRFY-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)aniline |
| InChIKey | YZTPLJDEDDWRFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NO1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)