CAS 500003-68-9 is the registry number for L-Penicillamine Tartrate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 500003-68-9) is a chemical compound with the molecular formula C9H17NO8S and a molecular weight of 299.30 g/mol. IUPAC name: (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: BIXMSPGOMAGLLA-VBHMSZNKSA-N.
| Molecular formula | C9H17NO8S |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | BIXMSPGOMAGLLA-VBHMSZNKSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)S.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)