CAS 851957-35-2 appears in our catalog under these names: Topiramate Impurity 2, Topiramate Impurity 3, Topiramate Impurity 15, 2,3-Desisopropylidene Topiramate, >95% (HPLC), 2,3-Desisopropylidene topiramate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
[(3aR,6R,7S,7aS)-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl sulfamate (CAS 851957-35-2) is a chemical compound with the molecular formula C9H17NO8S and a molecular weight of 299.30 g/mol. IUPAC name: [(3aR,6R,7S,7aS)-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl sulfamate. InChIKey: VQFMBYSMXMIARD-JAGXHNFQSA-N.
| Molecular formula | C9H17NO8S |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | [(3aR,6R,7S,7aS)-6,7-dihydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl sulfamate |
| InChIKey | VQFMBYSMXMIARD-JAGXHNFQSA-N |
| SMILES | CC1(O[C@@H]2CO[C@@]([C@H]([C@@H]2O1)O)(COS(=O)(=O)N)O)C |
Computed by PubChem (NCBI)