CAS 5002-60-8 is the registry number for (2R)-2,6-Diamino-N-((1S)-1-methyl-2-phenylethyl)-hexanamide. Offered by: Biosynth. Available pack sizes: 25mg, 50mg.
(2R)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide (CAS 5002-60-8) is a chemical compound with the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. IUPAC name: (2R)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide. InChIKey: VOBHXZCDAVEXEY-GXTWGEPZSA-N.
| Molecular formula | C15H25N3O |
|---|---|
| Molecular weight | 263.38 g/mol |
| IUPAC name | (2R)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
| InChIKey | VOBHXZCDAVEXEY-GXTWGEPZSA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)NC(=O)[C@@H](CCCCN)N |
Computed by PubChem (NCBI)