CAS 5006-79-1 is the registry number for Metronidazole Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethenyl-2-methyl-5-nitroimidazole (CAS 5006-79-1) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 1-ethenyl-2-methyl-5-nitroimidazole. InChIKey: AWJPSVDQGUYQSB-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 1-ethenyl-2-methyl-5-nitroimidazole |
| InChIKey | AWJPSVDQGUYQSB-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1C=C)[N+](=O)[O-] |
Computed by PubChem (NCBI)