CAS 501034-29-3 is the registry number for 2,3-Bis(4-bromophenyl)-2-cyclopropen-1-one. Offered by: TRC. Available pack sizes: 250mg.
2,3-bis(4-bromophenyl)cycloprop-2-en-1-one (CAS 501034-29-3) is a chemical compound with the molecular formula C15H8Br2O and a molecular weight of 364.03 g/mol. IUPAC name: 2,3-bis(4-bromophenyl)cycloprop-2-en-1-one. InChIKey: IXKVHLBQRZVJKN-UHFFFAOYSA-N.
| Molecular formula | C15H8Br2O |
|---|---|
| Molecular weight | 364.03 g/mol |
| IUPAC name | 2,3-bis(4-bromophenyl)cycloprop-2-en-1-one |
| InChIKey | IXKVHLBQRZVJKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C2=O)C3=CC=C(C=C3)Br)Br |
Computed by PubChem (NCBI)