CAS 944129-32-2 is the registry number for 3,7-Dibromo-dibenzo[a,d]cyclohepten-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (CAS 944129-32-2) is a chemical compound with the molecular formula C15H8Br2O and a molecular weight of 364.03 g/mol. IUPAC name: 5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one. InChIKey: FHFJGNMPGCZWCW-UHFFFAOYSA-N.
| Molecular formula | C15H8Br2O |
|---|---|
| Molecular weight | 364.03 g/mol |
| IUPAC name | 5,14-dibromotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| InChIKey | FHFJGNMPGCZWCW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)C(=O)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)