CAS 5019-24-9 appears in our catalog under these names: Methyl-2,3,4,6-tetra-o-acetyl-alpha-d-mannopyranoside, 95%, Methyl-2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methyl acetate (CAS 5019-24-9) is a chemical compound with the molecular formula C15H22O10 and a molecular weight of 362.33 g/mol. IUPAC name: [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methyl acetate. InChIKey: UYWUMFGDPBMNCA-MRLBHPIUSA-N.
| Molecular formula | C15H22O10 |
|---|---|
| Molecular weight | 362.33 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
| InChIKey | UYWUMFGDPBMNCA-MRLBHPIUSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)