CAS 77392-66-6 appears in our catalog under these names: Ethyl 2,3,4-tri-o-acetyl-beta-d-glucuronide methyl ester, 95%, Ethyl 2,3,4-Tri-O-acetyl-Beta-D-glucuronide, Methyl Ester, Ethyl 2,3,4–tri–O–acetyl–β–D–glucuronide methyl ester, Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester, Ethyl 2,3,4-tri-O-acetyl-β-D-glucuronide methyl ester, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 50mg, 5g, 10g.
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-ethoxyoxane-2-carboxylate (CAS 77392-66-6) is a chemical compound with the molecular formula C15H22O10 and a molecular weight of 362.33 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-ethoxyoxane-2-carboxylate. InChIKey: CWYBDXQVVNLNJG-XOBFJNJYSA-N.
| Molecular formula | C15H22O10 |
|---|---|
| Molecular weight | 362.33 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-ethoxyoxane-2-carboxylate |
| InChIKey | CWYBDXQVVNLNJG-XOBFJNJYSA-N |
| SMILES | CCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)