Products 501902-78-9
CAS 501902-78-9 is the registry number for 5-(4-Isobutylphenyl)-2H-pyrazol-3-ylamine. Offered by: Fluorochem. Available pack sizes: 250mg.
5-[4-(2-methylpropyl)phenyl]-1H-pyrazol-3-amine (CAS 501902-78-9) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: 5-[4-(2-methylpropyl)phenyl]-1H-pyrazol-3-amine. InChIKey: KQJFZAKQQVPXDJ-UHFFFAOYSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 5-[4-(2-methylpropyl)phenyl]-1H-pyrazol-3-amine |
| InChIKey | KQJFZAKQQVPXDJ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=CC(=NN2)N |
Computed by PubChem (NCBI)