Products 503308-96-1

CAS 503308-96-1 appears in our catalog under these names: 2,4-Dimethylthiophene-3-carboxylic acid, 95%, 2,4-Dimethylthiophene-3-carboxylic acid, 97%, 2,4-Dimethylthiophene-3-carboxylic acid, 2,4-Dimethylthiophene-3-carboxylic acid 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg, 100mg.

Structural formula: {0} (CAS {1})

2,4-dimethylthiophene-3-carboxylic acid (CAS 503308-96-1) is a chemical compound with the molecular formula C7H8O2S and a molecular weight of 156.20 g/mol. IUPAC name: 2,4-dimethylthiophene-3-carboxylic acid. InChIKey: NRYCOTXIOMJBLD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O2S
Molecular weight156.20 g/mol
IUPAC name2,4-dimethylthiophene-3-carboxylic acid
InChIKeyNRYCOTXIOMJBLD-UHFFFAOYSA-N
SMILESCC1=CSC(=C1C(=O)O)C

Computed by PubChem (NCBI)