Products 89639-74-7

CAS 89639-74-7 appears in our catalog under these names: 3,4-Dimethylthiophene-2-carboxylic acid, 95%, 3,4-Dimethylthiophene-2-carboxylic acid, 3,4-Dimethylthiophene-2-carboxylic acid 98%, 3,4-Dimethylthiophene-2-carboxylic acid, 97%, 97%, 3,4-Dimethylthiophene-2-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

3,4-dimethylthiophene-2-carboxylic acid (CAS 89639-74-7) is a chemical compound with the molecular formula C7H8O2S and a molecular weight of 156.20 g/mol. IUPAC name: 3,4-dimethylthiophene-2-carboxylic acid. InChIKey: RPZBMBIIOOKZMB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O2S
Molecular weight156.20 g/mol
IUPAC name3,4-dimethylthiophene-2-carboxylic acid
InChIKeyRPZBMBIIOOKZMB-UHFFFAOYSA-N
SMILESCC1=CSC(=C1C)C(=O)O

Computed by PubChem (NCBI)