CAS 5034-68-4 appears in our catalog under these names: (S)-4-(2-Amino-3-hydroxypropyl)phenol, 95+%, L-Tyrosinol, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
4-[(2S)-2-amino-3-hydroxypropyl]phenol (CAS 5034-68-4) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. IUPAC name: 4-[(2S)-2-amino-3-hydroxypropyl]phenol. InChIKey: DBLDQZASZZMNSL-QMMMGPOBSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 167.20 g/mol |
| IUPAC name | 4-[(2S)-2-amino-3-hydroxypropyl]phenol |
| InChIKey | DBLDQZASZZMNSL-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CO)N)O |
Computed by PubChem (NCBI)