CAS 58889-64-8 net is the registry number for H-D-Tyr-ol*HCl. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
4-[(2R)-2-amino-3-hydroxypropyl]phenol (CAS 58889-64-8) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. IUPAC name: 4-[(2R)-2-amino-3-hydroxypropyl]phenol. InChIKey: DBLDQZASZZMNSL-MRVPVSSYSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 167.20 g/mol |
| IUPAC name | 4-[(2R)-2-amino-3-hydroxypropyl]phenol |
| InChIKey | DBLDQZASZZMNSL-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CO)N)O |
Computed by PubChem (NCBI)