CAS 503536-71-8 appears in our catalog under these names: N4',N4'-Dimethyl-(1,1'-biphenyl)-3,4'-diamine, 97%, 4-(3-Aminophenyl)-N,N-dimethylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-[4-(dimethylamino)phenyl]aniline (CAS 503536-71-8) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]aniline. InChIKey: LYFZESCMIGUOPB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]aniline |
| InChIKey | LYFZESCMIGUOPB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)