CAS 503598-78-5 appears in our catalog under these names: Imidafenacin Impurity 3, Imidafenacin Impurity 4, Imidafenacin Impurity 22. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-2,2-diphenylbutanamide (CAS 503598-78-5) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: 4-amino-2,2-diphenylbutanamide. InChIKey: YRRGEYZHXPKODH-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | 4-amino-2,2-diphenylbutanamide |
| InChIKey | YRRGEYZHXPKODH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCN)(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)