Products 50372-80-0
CAS 50372-80-0 appears in our catalog under these names: (1R-(exo,exo))-8-Methyl-3-phenyl-8-azabicyclo(3.2.1)octane-2-carboxylic Acid Methyl Ester, >95% (HPLC), (1R-(Exo,exo))-8-methyl-3-phenyl-8-azabicyclo(3.2.1)octane-2-carboxylic acid methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 5mg, 10mg, 50mg, 100mg.
Methyl (1R,2S,3S,5S)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 50372-80-0) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: methyl (1R,2S,3S,5S)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: OMBOXYLBBHNWHL-YJNKXOJESA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | methyl (1R,2S,3S,5S)-8-methyl-3-phenyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | OMBOXYLBBHNWHL-YJNKXOJESA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)