CAS 503834-41-1 appears in our catalog under these names: Paroxetine EP Impurity H HCl, ((3S,4R)-1-Benzyl-4-(4-fluorophenyl)piperidin-3-yl)methanol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]methanol;hydrochloride (CAS 503834-41-1) is a chemical compound with the molecular formula C19H23ClFNO and a molecular weight of 335.8 g/mol. IUPAC name: [(3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]methanol;hydrochloride. InChIKey: SQSWEIGDLXHNTO-QQTWVUFVSA-N.
| Molecular formula | C19H23ClFNO |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | [(3S,4R)-1-benzyl-4-(4-fluorophenyl)piperidin-3-yl]methanol;hydrochloride |
| InChIKey | SQSWEIGDLXHNTO-QQTWVUFVSA-N |
| SMILES | C1CN(C[C@H]([C@@H]1C2=CC=C(C=C2)F)CO)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)