CAS 785792-27-0 is the registry number for N-(Adamantan-1-yl)-2-chloro-N-((4-fluorophenyl)methyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(1-adamantyl)-2-chloro-N-[(4-fluorophenyl)methyl]acetamide (CAS 785792-27-0) is a chemical compound with the molecular formula C19H23ClFNO and a molecular weight of 335.8 g/mol. IUPAC name: N-(1-adamantyl)-2-chloro-N-[(4-fluorophenyl)methyl]acetamide. InChIKey: JMFUCWQPDQMNHC-UHFFFAOYSA-N.
| Molecular formula | C19H23ClFNO |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | N-(1-adamantyl)-2-chloro-N-[(4-fluorophenyl)methyl]acetamide |
| InChIKey | JMFUCWQPDQMNHC-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)N(CC4=CC=C(C=C4)F)C(=O)CCl |
Computed by PubChem (NCBI)