CAS 50402-57-8 appears in our catalog under these names: 8-(2-Aminoethylamino)-1-naphthalenesulfonic acid, 95%, N-(Aminoethyl)-8-naphthylamine-1-sulfonic Acid. Offered by: Combi-blocks, TRC, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 2g, 500mg, 500 mg, 1 g, 100 mg.
8-(2-aminoethylamino)naphthalene-1-sulfonic acid (CAS 50402-57-8) is a chemical compound with the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. IUPAC name: 8-(2-aminoethylamino)naphthalene-1-sulfonic acid. InChIKey: XCNDHKWVELDQPO-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 8-(2-aminoethylamino)naphthalene-1-sulfonic acid |
| InChIKey | XCNDHKWVELDQPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NCCN)C(=CC=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)