CAS 791582-43-9 appears in our catalog under these names: Ertapenem Side Chain Enantiomer, 3-((((2R,4R)-4-Mercapto-2-pyrrolidinyl)carbonyl)amino)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
3-[[(2R,4R)-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid (CAS 791582-43-9) is a chemical compound with the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. IUPAC name: 3-[[(2R,4R)-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid. InChIKey: ZLBHUAPMWZWODX-NXEZZACHSA-N.
| Molecular formula | C12H14N2O3S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 3-[[(2R,4R)-4-sulfanylpyrrolidine-2-carbonyl]amino]benzoic acid |
| InChIKey | ZLBHUAPMWZWODX-NXEZZACHSA-N |
| SMILES | C1[C@H](CN[C@H]1C(=O)NC2=CC=CC(=C2)C(=O)O)S |
Computed by PubChem (NCBI)