Products 50408-95-2
CAS 50408-95-2 is the registry number for 2,4-Dichloro-3,5-difluoroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
2,4-dichloro-3,5-difluoroaniline (CAS 50408-95-2) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 2,4-dichloro-3,5-difluoroaniline. InChIKey: CQYFSYCXGWMSBI-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 2,4-dichloro-3,5-difluoroaniline |
| InChIKey | CQYFSYCXGWMSBI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)Cl)N |
Computed by PubChem (NCBI)