CAS 83121-15-7 appears in our catalog under these names: 3,5-Dichloro-2,4-difluoroaniline, 3,5–Dichloro–2,4–difluoroaniline, 3,5-Dichloro-2,4-difluoroaniline, >94.0%(GC), 3,5-Dichloro-2,4-difluoroaniline 98%, 3,5-DICHLORO-2,4-DIFLUORO-BENZENAMINE, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 500mg, 100g, 25g, 5g, 1g.
3,5-dichloro-2,4-difluoroaniline (CAS 83121-15-7) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,5-dichloro-2,4-difluoroaniline. InChIKey: KLECNQGLBJHVSH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,5-dichloro-2,4-difluoroaniline |
| InChIKey | KLECNQGLBJHVSH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)Cl)F)N |
Computed by PubChem (NCBI)