Products 1374659-33-2
CAS 1374659-33-2 is the registry number for 3,5-Dichloro-4-(difluoromethyl)pyridine. Offered by: Fluorochem. Available pack sizes: 1g.
3,5-dichloro-4-(difluoromethyl)pyridine (CAS 1374659-33-2) is a chemical compound with the molecular formula C6H3Cl2F2N and a molecular weight of 197.99 g/mol. IUPAC name: 3,5-dichloro-4-(difluoromethyl)pyridine. InChIKey: SQQNYQZGLSIAIG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2N |
|---|---|
| Molecular weight | 197.99 g/mol |
| IUPAC name | 3,5-dichloro-4-(difluoromethyl)pyridine |
| InChIKey | SQQNYQZGLSIAIG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(F)F)Cl |
Computed by PubChem (NCBI)