CAS 5042-55-7 appears in our catalog under these names: 5-Nitrobenzene-1,3-diamine, 95%, 5–Nitrobenzene–1,3–diamine, 5-Nitro-m-phenylenediamine, 5-Nitrobenzene-1,3-diamine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 100mg, 0,25g, 0,5g.
5-nitrobenzene-1,3-diamine (CAS 5042-55-7) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 5-nitrobenzene-1,3-diamine. InChIKey: DFWXYHZQNLIBLY-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 5-nitrobenzene-1,3-diamine |
| InChIKey | DFWXYHZQNLIBLY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)