CAS 50483-32-4 is the registry number for 4-(tert-Butyl)naphthalen-1-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butylnaphthalen-1-ol (CAS 50483-32-4) is a chemical compound with the molecular formula C14H16O and a molecular weight of 200.28 g/mol. IUPAC name: 4-tert-butylnaphthalen-1-ol. InChIKey: CGKJTQFVWGRAMC-UHFFFAOYSA-N.
| Molecular formula | C14H16O |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 4-tert-butylnaphthalen-1-ol |
| InChIKey | CGKJTQFVWGRAMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)