Products 50501-07-0

CAS 50501-07-0 appears in our catalog under these names: Ethyl Indoline–2–carboxylate, Ethyl Indoline-2-carboxylate, >95.0%(GC), Ethyl indoline-2-carboxylate 95%, Ethyl Indoline-2-carboxylate, 95%, 95%, Ethyl indoline-2-carboxylate, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2,3-dihydro-1H-indole-2-carboxylate (CAS 50501-07-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: ethyl 2,3-dihydro-1H-indole-2-carboxylate. InChIKey: KISPUTPAKVZNBI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC nameethyl 2,3-dihydro-1H-indole-2-carboxylate
InChIKeyKISPUTPAKVZNBI-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC2=CC=CC=C2N1

Computed by PubChem (NCBI)